Products 1240527-39-2
CAS 1240527-39-2 is the registry number for 3-Amino-1,1,1-trifluoro-2-phenylpropan-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-amino-1,1,1-trifluoro-2-phenylpropan-2-ol;hydrochloride (CAS 1240527-39-2) is a chemical compound with the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. IUPAC name: 3-amino-1,1,1-trifluoro-2-phenylpropan-2-ol;hydrochloride. InChIKey: SQHUFJXWRGURQO-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3NO |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | 3-amino-1,1,1-trifluoro-2-phenylpropan-2-ol;hydrochloride |
| InChIKey | SQHUFJXWRGURQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)