CAS 1241040-16-3 appears in our catalog under these names: N-(2H-1,3-Benzodioxol-5-yl)-2-hydroxypropanamide, 95%, N-(1,3-Dioxaindan-5-yl)-2-hydroxypropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
N-(1,3-benzodioxol-5-yl)-2-hydroxypropanamide (CAS 1241040-16-3) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-2-hydroxypropanamide. InChIKey: DEDYDJBOLQRCQS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-2-hydroxypropanamide |
| InChIKey | DEDYDJBOLQRCQS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC2=C(C=C1)OCO2)O |
Computed by PubChem (NCBI)