CAS 1241255-45-7 is the registry number for 2-(6,7-Dihydrothieno[3,2-c]pyridin-5(4H)-yl)-6-fluorobenzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-6-fluorobenzonitrile (CAS 1241255-45-7) is a chemical compound with the molecular formula C14H11FN2S and a molecular weight of 258.32 g/mol. IUPAC name: 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-6-fluorobenzonitrile. InChIKey: TUSUJHIBGLLKTO-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2S |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-6-fluorobenzonitrile |
| InChIKey | TUSUJHIBGLLKTO-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)C3=C(C(=CC=C3)F)C#N |
Computed by PubChem (NCBI)