Products 852399-68-9

CAS 852399-68-9 is the registry number for N-(3-Fluoro-4-methylphenyl)-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

N-(3-fluoro-4-methylphenyl)-1,3-benzothiazol-2-amine (CAS 852399-68-9) is a chemical compound with the molecular formula C14H11FN2S and a molecular weight of 258.32 g/mol. IUPAC name: N-(3-fluoro-4-methylphenyl)-1,3-benzothiazol-2-amine. InChIKey: RTMGZIDBXNDCBK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11FN2S
Molecular weight258.32 g/mol
IUPAC nameN-(3-fluoro-4-methylphenyl)-1,3-benzothiazol-2-amine
InChIKeyRTMGZIDBXNDCBK-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)NC2=NC3=CC=CC=C3S2)F

Computed by PubChem (NCBI)