CAS 260443-89-8 appears in our catalog under these names: 4-(5-Fluoro-1,3-benzothiazol-2-yl)-2-methylaniline, 95%, 5F-203, 98%, 5-fluoro 203/ 98.02% (existing batch purity), 5–fluoro 203, 5F-203. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 5mg, 1mg, 10mg, 2mg, 25mg, 50mg, 200mg.
4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methylaniline (CAS 260443-89-8) is a chemical compound with the molecular formula C14H11FN2S and a molecular weight of 258.32 g/mol. IUPAC name: 4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methylaniline. InChIKey: IFWLHIIUGSEKKE-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2S |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | 4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methylaniline |
| InChIKey | IFWLHIIUGSEKKE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NC3=C(S2)C=CC(=C3)F)N |
Computed by PubChem (NCBI)