CAS 923893-82-7 is the registry number for N-((4-Fluorophenyl)methyl)-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
N-[(4-fluorophenyl)methyl]-1,3-benzothiazol-2-amine (CAS 923893-82-7) is a chemical compound with the molecular formula C14H11FN2S and a molecular weight of 258.32 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]-1,3-benzothiazol-2-amine. InChIKey: UQMCXRXWSMGGDC-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2S |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]-1,3-benzothiazol-2-amine |
| InChIKey | UQMCXRXWSMGGDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NCC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)