Products 131169-64-7

CAS 131169-64-7 is the registry number for N-Benzyl-6-fluoro-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

N-benzyl-6-fluoro-1,3-benzothiazol-2-amine (CAS 131169-64-7) is a chemical compound with the molecular formula C14H11FN2S and a molecular weight of 258.32 g/mol. IUPAC name: N-benzyl-6-fluoro-1,3-benzothiazol-2-amine. InChIKey: AASSTUSOWJMKQD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11FN2S
Molecular weight258.32 g/mol
IUPAC nameN-benzyl-6-fluoro-1,3-benzothiazol-2-amine
InChIKeyAASSTUSOWJMKQD-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CNC2=NC3=C(S2)C=C(C=C3)F

Computed by PubChem (NCBI)