Products 1241675-38-6
CAS 1241675-38-6 appears in our catalog under these names: Benzoic acid, 2-(acetylamino)-4-bromo-, methyl ester, 95%, Methyl 2-acetamido-4-bromobenzoate, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 2-acetamido-4-bromobenzoate (CAS 1241675-38-6) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: methyl 2-acetamido-4-bromobenzoate. InChIKey: XWZNILWYRRXBBC-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | methyl 2-acetamido-4-bromobenzoate |
| InChIKey | XWZNILWYRRXBBC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)