CAS 124188-37-0 appears in our catalog under these names: 6-Chloro-2,2-dimethyl-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 6–Chloro–2,2–dimethyl–2H–benzo(b)(1,4)oxazin–3(4H)–one, 6-Chloro-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 95+%, 95+%, 6-CHLORO-2,2-DIMETHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 95+%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
6-chloro-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CAS 124188-37-0) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 6-chloro-2,2-dimethyl-4H-1,4-benzoxazin-3-one. InChIKey: NWYTWVIFIKWAEO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 6-chloro-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| InChIKey | NWYTWVIFIKWAEO-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=C2)Cl)C |
Computed by PubChem (NCBI)