Products 1241950-73-1
CAS 1241950-73-1 appears in our catalog under these names: 2-Ethyl-1h-pyrrolo[2,3-b]pyridine-5-carboxylic acid, 98%, 2-Ethyl-1H-pyrrolo(2,3-b)pyridine-5-carboxylic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-ethyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid (CAS 1241950-73-1) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2-ethyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid. InChIKey: YZHXLFCIHKFJDA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-ethyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid |
| InChIKey | YZHXLFCIHKFJDA-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=CC(=CN=C2N1)C(=O)O |
Computed by PubChem (NCBI)