Products 1242249-45-1
CAS 1242249-45-1 is the registry number for 4-Chloro-3-(propan-2-yl)-1H-pyrazolo(4,3-c)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-3-propan-2-yl-2H-pyrazolo[4,3-c]pyridine (CAS 1242249-45-1) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 4-chloro-3-propan-2-yl-2H-pyrazolo[4,3-c]pyridine. InChIKey: YAYNGDQEUOQIHG-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 4-chloro-3-propan-2-yl-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | YAYNGDQEUOQIHG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=NN1)C=CN=C2Cl |
Computed by PubChem (NCBI)