Products 1242268-04-7
CAS 1242268-04-7 is the registry number for Methyl 2-cyano-2-(5-cyano-2-pyridinyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-cyano-2-(5-cyano-2-pyridinyl)acetate (CAS 1242268-04-7) is a chemical compound with the molecular formula C10H7N3O2 and a molecular weight of 201.18 g/mol. IUPAC name: methyl 2-cyano-2-(5-cyano-2-pyridinyl)acetate. InChIKey: XXLPXBLMHYJODO-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O2 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | methyl 2-cyano-2-(5-cyano-2-pyridinyl)acetate |
| InChIKey | XXLPXBLMHYJODO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C#N)C1=NC=C(C=C1)C#N |
Computed by PubChem (NCBI)