CAS 200062-06-2 is the registry number for 5-(1H-Indol-3-yl)-1,3,4-oxadiazol-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1H-indol-3-yl)-3H-1,3,4-oxadiazol-2-one (CAS 200062-06-2) is a chemical compound with the molecular formula C10H7N3O2 and a molecular weight of 201.18 g/mol. IUPAC name: 5-(1H-indol-3-yl)-3H-1,3,4-oxadiazol-2-one. InChIKey: JVRRKRQQUPJXHN-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O2 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 5-(1H-indol-3-yl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | JVRRKRQQUPJXHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=NNC(=O)O3 |
Computed by PubChem (NCBI)