Products 796972-98-0

CAS 796972-98-0 is the registry number for 2-(7-Cyano-1H-benzo[d]imidazol-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(7-cyanobenzimidazol-1-yl)acetic acid (CAS 796972-98-0) is a chemical compound with the molecular formula C10H7N3O2 and a molecular weight of 201.18 g/mol. IUPAC name: 2-(7-cyanobenzimidazol-1-yl)acetic acid. InChIKey: CTMUOPMCEIJFPH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7N3O2
Molecular weight201.18 g/mol
IUPAC name2-(7-cyanobenzimidazol-1-yl)acetic acid
InChIKeyCTMUOPMCEIJFPH-UHFFFAOYSA-N
SMILESC1=CC(=C2C(=C1)N=CN2CC(=O)O)C#N

Computed by PubChem (NCBI)