CAS 95633-27-5 appears in our catalog under these names: 7–Azido–4–methylcoumarin, 7-Azido-4-methylcoumarin, 7-Azido-4-methylcoumarin 98%, 7-AZIDO-4-METHYLCOUMARIN, 97%, 7-Azido-4-methyl-2H-1-benzopyran-2-one, 98%, 98%. Offered by: GLPBio, TRC, TargetMol, Chemat, Ambeed. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg, 250mg, 1g.
7-azido-4-methylchromen-2-one (CAS 95633-27-5) is a chemical compound with the molecular formula C10H7N3O2 and a molecular weight of 201.18 g/mol. IUPAC name: 7-azido-4-methylchromen-2-one. InChIKey: HEKDKVLIMUWRRZ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O2 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 7-azido-4-methylchromen-2-one |
| InChIKey | HEKDKVLIMUWRRZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)N=[N+]=[N-] |
Computed by PubChem (NCBI)