CAS 865886-90-4 is the registry number for 1,8-Dihydro-Pyrrolo(3,2-g)indazole-3-carboxylic acid. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dihydropyrrolo[3,2-g]indazole-3-carboxylic acid (CAS 865886-90-4) is a chemical compound with the molecular formula C10H7N3O2 and a molecular weight of 201.18 g/mol. IUPAC name: 1,2-dihydropyrrolo[3,2-g]indazole-3-carboxylic acid. InChIKey: CTLKJGAOCDISAE-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O2 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 1,2-dihydropyrrolo[3,2-g]indazole-3-carboxylic acid |
| InChIKey | CTLKJGAOCDISAE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NNC2=C3C1=CC=N3)C(=O)O |
Computed by PubChem (NCBI)