CAS 1242336-68-0 is the registry number for 5-Chloro-3'-methylbiphenyl-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-chloro-5-(3-methylphenyl)benzoic acid (CAS 1242336-68-0) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 3-chloro-5-(3-methylphenyl)benzoic acid. InChIKey: YRZCCQASYVBQBB-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 3-chloro-5-(3-methylphenyl)benzoic acid |
| InChIKey | YRZCCQASYVBQBB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC(=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)