Products 1242471-40-4
CAS 1242471-40-4 appears in our catalog under these names: 4,5-Dihydro-alpha-(hydroxymethyl)-alpha,3-dimethyl-5-oxo-1-phenyl-1h-pyrazole-4-methanesulfonic acid, 95%, Edaravone Impurity 24, Edaravone Impurity 6. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin. Available pack sizes: 100mg, on request, 10mg, 25mg, 50mg, 200mg.
1-hydroxy-2-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)propane-2-sulfonic acid (CAS 1242471-40-4) is a chemical compound with the molecular formula C13H16N2O5S and a molecular weight of 312.34 g/mol. IUPAC name: 1-hydroxy-2-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)propane-2-sulfonic acid. InChIKey: WCLOHCKSKIDBJY-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5S |
|---|---|
| Molecular weight | 312.34 g/mol |
| IUPAC name | 1-hydroxy-2-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)propane-2-sulfonic acid |
| InChIKey | WCLOHCKSKIDBJY-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1C(C)(CO)S(=O)(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)