CAS 923212-38-8 appears in our catalog under these names: 1-([4-(Aminocarbonyl)phenyl]sulfonyl)piperidine-4-carboxylic acid, 95%, 1-(4-Carbamoylbenzenesulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
1-(4-carbamoylphenyl)sulfonylpiperidine-4-carboxylic acid (CAS 923212-38-8) is a chemical compound with the molecular formula C13H16N2O5S and a molecular weight of 312.34 g/mol. IUPAC name: 1-(4-carbamoylphenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: PREFKDFRNVHQQN-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5S |
|---|---|
| Molecular weight | 312.34 g/mol |
| IUPAC name | 1-(4-carbamoylphenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | PREFKDFRNVHQQN-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)C2=CC=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)