CAS 40563-70-0 is the registry number for Variamine blue b sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g.
4-N-(4-methoxyphenyl)benzene-1,4-diamine;sulfuric acid (CAS 40563-70-0) is a chemical compound with the molecular formula C13H16N2O5S and a molecular weight of 312.34 g/mol. IUPAC name: 4-N-(4-methoxyphenyl)benzene-1,4-diamine;sulfuric acid. InChIKey: BMSZNBNGDJDEOC-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5S |
|---|---|
| Molecular weight | 312.34 g/mol |
| IUPAC name | 4-N-(4-methoxyphenyl)benzene-1,4-diamine;sulfuric acid |
| InChIKey | BMSZNBNGDJDEOC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=CC=C(C=C2)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)