CAS 927869-63-4 is the registry number for 3-(2-Oxo-2,3,4,5-tetrahydro-1H-1-benzazepine-7-sulfonamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)sulfonylamino]propanoic acid (CAS 927869-63-4) is a chemical compound with the molecular formula C13H16N2O5S and a molecular weight of 312.34 g/mol. IUPAC name: 3-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)sulfonylamino]propanoic acid. InChIKey: CVRRJYCKLIYHFW-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5S |
|---|---|
| Molecular weight | 312.34 g/mol |
| IUPAC name | 3-[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)sulfonylamino]propanoic acid |
| InChIKey | CVRRJYCKLIYHFW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)S(=O)(=O)NCCC(=O)O)NC(=O)C1 |
Computed by PubChem (NCBI)