CAS 899718-42-4 appears in our catalog under these names: ([(1-Propionyl-2,3-dihydro-1h-indol-5-yl)sulfonyl]amino)acetic acid, 95%, 2-(1-Propionylindoline-5-sulfonamido)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]acetic acid (CAS 899718-42-4) is a chemical compound with the molecular formula C13H16N2O5S and a molecular weight of 312.34 g/mol. IUPAC name: 2-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]acetic acid. InChIKey: QIFWGMGTHOHGKO-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5S |
|---|---|
| Molecular weight | 312.34 g/mol |
| IUPAC name | 2-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]acetic acid |
| InChIKey | QIFWGMGTHOHGKO-UHFFFAOYSA-N |
| SMILES | CCC(=O)N1CCC2=C1C=CC(=C2)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)