CAS 1243022-01-6 is the registry number for 4-Benzyl-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-benzyl-1H-pyrido[2,3-b]pyrazine-2,3-dione (CAS 1243022-01-6) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 4-benzyl-1H-pyrido[2,3-b]pyrazine-2,3-dione. InChIKey: STXRZXASFIXKPI-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 4-benzyl-1H-pyrido[2,3-b]pyrazine-2,3-dione |
| InChIKey | STXRZXASFIXKPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=CC=N3)NC(=O)C2=O |
Computed by PubChem (NCBI)