Products 1243274-81-8
CAS 1243274-81-8 appears in our catalog under these names: Solifenacin Impurity 45, Solifenacin Impurity 1 ((R)-4-Nitrophenyl Quinuclidin-3-yl Carbonate) HCl. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] (4-nitrophenyl) carbonate (CAS 1243274-81-8) is a chemical compound with the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. IUPAC name: [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (4-nitrophenyl) carbonate. InChIKey: IPSWQNYZUPFBSZ-ZDUSSCGKSA-N.
| Molecular formula | C14H16N2O5 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (4-nitrophenyl) carbonate |
| InChIKey | IPSWQNYZUPFBSZ-ZDUSSCGKSA-N |
| SMILES | C1CN2CCC1[C@H](C2)OC(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)