CAS 1243313-06-5 appears in our catalog under these names: 1-Bromo-3-cyclopropoxy-5-(trifluoromethyl)benzene, 98%, 1-Bromo-3-cyclopropoxy-5-(trifluoromethyl)benzene, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1-bromo-3-cyclopropyloxy-5-(trifluoromethyl)benzene (CAS 1243313-06-5) is a chemical compound with the molecular formula C10H8BrF3O and a molecular weight of 281.07 g/mol. IUPAC name: 1-bromo-3-cyclopropyloxy-5-(trifluoromethyl)benzene. InChIKey: MJUPFCSYYYLEBB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O |
|---|---|
| Molecular weight | 281.07 g/mol |
| IUPAC name | 1-bromo-3-cyclopropyloxy-5-(trifluoromethyl)benzene |
| InChIKey | MJUPFCSYYYLEBB-UHFFFAOYSA-N |
| SMILES | C1CC1OC2=CC(=CC(=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)