CAS 1250793-81-7 appears in our catalog under these names: 3-Bromo-4-(2,3,4-trifluorophenyl)butan-2-one, 95%, 3-Bromo-4-(2,3,4-trifluorophenyl)butan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-bromo-4-(2,3,4-trifluorophenyl)butan-2-one (CAS 1250793-81-7) is a chemical compound with the molecular formula C10H8BrF3O and a molecular weight of 281.07 g/mol. IUPAC name: 3-bromo-4-(2,3,4-trifluorophenyl)butan-2-one. InChIKey: SHCZWKXWAAEKFJ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O |
|---|---|
| Molecular weight | 281.07 g/mol |
| IUPAC name | 3-bromo-4-(2,3,4-trifluorophenyl)butan-2-one |
| InChIKey | SHCZWKXWAAEKFJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CC1=C(C(=C(C=C1)F)F)F)Br |
Computed by PubChem (NCBI)