Products 1422237-44-2
CAS 1422237-44-2 is the registry number for 4-(2-Bromophenyl)-1,1,1-trifluorobutan-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-bromophenyl)-1,1,1-trifluorobutan-2-one (CAS 1422237-44-2) is a chemical compound with the molecular formula C10H8BrF3O and a molecular weight of 281.07 g/mol. IUPAC name: 4-(2-bromophenyl)-1,1,1-trifluorobutan-2-one. InChIKey: WPGYJENEMWEKHQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O |
|---|---|
| Molecular weight | 281.07 g/mol |
| IUPAC name | 4-(2-bromophenyl)-1,1,1-trifluorobutan-2-one |
| InChIKey | WPGYJENEMWEKHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)