Products 2917507-33-4
CAS 2917507-33-4 is the registry number for 1-(5-Bromo-3-(1,1-difluoroethyl)-2-fluorophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[5-bromo-3-(1,1-difluoroethyl)-2-fluorophenyl]ethanone (CAS 2917507-33-4) is a chemical compound with the molecular formula C10H8BrF3O and a molecular weight of 281.07 g/mol. IUPAC name: 1-[5-bromo-3-(1,1-difluoroethyl)-2-fluorophenyl]ethanone. InChIKey: UQGNMKNHQVSOBO-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O |
|---|---|
| Molecular weight | 281.07 g/mol |
| IUPAC name | 1-[5-bromo-3-(1,1-difluoroethyl)-2-fluorophenyl]ethanone |
| InChIKey | UQGNMKNHQVSOBO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Br)C(C)(F)F)F |
Computed by PubChem (NCBI)