CAS 2768155-76-4 is the registry number for 5-Bromo-3-methyl-7-(trifluoromethyl)-2,3-dihydrobenzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-methyl-7-(trifluoromethyl)-2,3-dihydro-1-benzofuran (CAS 2768155-76-4) is a chemical compound with the molecular formula C10H8BrF3O and a molecular weight of 281.07 g/mol. IUPAC name: 5-bromo-3-methyl-7-(trifluoromethyl)-2,3-dihydro-1-benzofuran. InChIKey: VZFGTXQCXWNKTH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O |
|---|---|
| Molecular weight | 281.07 g/mol |
| IUPAC name | 5-bromo-3-methyl-7-(trifluoromethyl)-2,3-dihydro-1-benzofuran |
| InChIKey | VZFGTXQCXWNKTH-UHFFFAOYSA-N |
| SMILES | CC1COC2=C1C=C(C=C2C(F)(F)F)Br |
Computed by PubChem (NCBI)