CAS 1243364-91-1 appears in our catalog under these names: 3-Hydroxy-5-(methylsulfonamido)benzoic Acid, 95+%, 3-Hydroxy-5-(methylsulfonamido)benzoic Acid, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
3-hydroxy-5-(methanesulfonamido)benzoic acid (CAS 1243364-91-1) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: 3-hydroxy-5-(methanesulfonamido)benzoic acid. InChIKey: XPCOEDMQLLTOQP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 3-hydroxy-5-(methanesulfonamido)benzoic acid |
| InChIKey | XPCOEDMQLLTOQP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC(=CC(=C1)C(=O)O)O |
Computed by PubChem (NCBI)