CAS 124358-24-3 is the registry number for Ethyl 2-methyl-5-nitrobenzoate, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
Ethyl 2-methyl-5-nitrobenzoate (CAS 124358-24-3) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: ethyl 2-methyl-5-nitrobenzoate. InChIKey: OWSPBONPFGBEFL-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | ethyl 2-methyl-5-nitrobenzoate |
| InChIKey | OWSPBONPFGBEFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)