CAS 1244954-16-2 is the registry number for 1,2,3,4-Tetrahydro-1,4-epoxynaphthalene-1-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylic acid (CAS 1244954-16-2) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylic acid. InChIKey: ZRBQIRRMWRKZTO-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxylic acid |
| InChIKey | ZRBQIRRMWRKZTO-UHFFFAOYSA-N |
| SMILES | C1CC2(C3=CC=CC=C3C1O2)C(=O)O |
Computed by PubChem (NCBI)