Products 1245141-31-4
CAS 1245141-31-4 appears in our catalog under these names: (2S)-3-[4-(tert-butoxy)phenyl]-2-{[(prop-2-en-1-yloxy)carbonyl]amino}propanoic acid, >95%, Aloc-L-Tyr(tBu)-OH*DCHA. Offered by: Chemat, Iris Biotech. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(prop-2-enoxycarbonylamino)propanoic acid (CAS 1245141-31-4) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: (2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(prop-2-enoxycarbonylamino)propanoic acid. InChIKey: LHCGMTPKPBFNMM-AWEZNQCLSA-N.
| Molecular formula | C17H23NO5 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(prop-2-enoxycarbonylamino)propanoic acid |
| InChIKey | LHCGMTPKPBFNMM-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC=C |
Computed by PubChem (NCBI)