CAS 1245149-27-2 appears in our catalog under these names: 1-(4-Fluorophenyl)-4,5-dihydro-1h-pyrazol-5-one, 95%, 1-(4-Fluorophenyl)-4,5-dihydro-1H-pyrazol-5-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2-(4-fluorophenyl)-4H-pyrazol-3-one (CAS 1245149-27-2) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: 2-(4-fluorophenyl)-4H-pyrazol-3-one. InChIKey: MMUTYAHOABILOA-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-4H-pyrazol-3-one |
| InChIKey | MMUTYAHOABILOA-UHFFFAOYSA-N |
| SMILES | C1C=NN(C1=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)