CAS 1245533-64-5 is the registry number for N-(5-Amino-2-methylphenyl)-[1,1'-biphenyl]-4-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-amino-2-methylphenyl)-4-phenylbenzamide (CAS 1245533-64-5) is a chemical compound with the molecular formula C20H18N2O and a molecular weight of 302.4 g/mol. IUPAC name: N-(5-amino-2-methylphenyl)-4-phenylbenzamide. InChIKey: CPENLXZUDDVEDZ-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | N-(5-amino-2-methylphenyl)-4-phenylbenzamide |
| InChIKey | CPENLXZUDDVEDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)NC(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)