CAS 946387-25-3 is the registry number for 3-(tert-butyl)-2-phenylindeno(3,2-c)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg, 2000mg, 5000mg.
3-tert-butyl-2-phenylindeno[1,2-c]pyrazol-4-one (CAS 946387-25-3) is a chemical compound with the molecular formula C20H18N2O and a molecular weight of 302.4 g/mol. IUPAC name: 3-tert-butyl-2-phenylindeno[1,2-c]pyrazol-4-one. InChIKey: VZJRZEZTGFAVIH-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 3-tert-butyl-2-phenylindeno[1,2-c]pyrazol-4-one |
| InChIKey | VZJRZEZTGFAVIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C2C(=NN1C3=CC=CC=C3)C4=CC=CC=C4C2=O |
Computed by PubChem (NCBI)