CAS 709000-02-2 appears in our catalog under these names: 2-[1-(6-Methoxy-2-naphthyl)ethyl]-1h-benzimidazole, 95%, 2–(1–(6–Methoxynaphthalen–2–yl)ethyl)–1H–benzo(d)imidazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 10g, 5g.
2-[1-(6-methoxynaphthalen-2-yl)ethyl]-1H-benzimidazole (CAS 709000-02-2) is a chemical compound with the molecular formula C20H18N2O and a molecular weight of 302.4 g/mol. IUPAC name: 2-[1-(6-methoxynaphthalen-2-yl)ethyl]-1H-benzimidazole. InChIKey: UDIAOOPLLRAFMQ-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 2-[1-(6-methoxynaphthalen-2-yl)ethyl]-1H-benzimidazole |
| InChIKey | UDIAOOPLLRAFMQ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C=C(C=C2)OC)C3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)