Products 3003751-14-9
CAS 3003751-14-9 is the registry number for hCYP3A4-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-[4-(dimethylamino)phenyl]-3-isoquinolin-6-ylprop-2-en-1-one (CAS 3003751-14-9) is a chemical compound with the molecular formula C20H18N2O and a molecular weight of 302.4 g/mol. IUPAC name: (E)-1-[4-(dimethylamino)phenyl]-3-isoquinolin-6-ylprop-2-en-1-one. InChIKey: GJMNSVINGWNJFM-ONNFQVAWSA-N.
| Molecular formula | C20H18N2O |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (E)-1-[4-(dimethylamino)phenyl]-3-isoquinolin-6-ylprop-2-en-1-one |
| InChIKey | GJMNSVINGWNJFM-ONNFQVAWSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)/C=C/C2=CC3=C(C=C2)C=NC=C3 |
Computed by PubChem (NCBI)