CAS 380323-55-7 is the registry number for 4-(1-(2,2-Diphenylhydrazineylidene)ethyl)phenol. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[(E)-C-methyl-N-(N-phenylanilino)carbonimidoyl]phenol (CAS 380323-55-7) is a chemical compound with the molecular formula C20H18N2O and a molecular weight of 302.4 g/mol. IUPAC name: 4-[(E)-C-methyl-N-(N-phenylanilino)carbonimidoyl]phenol. InChIKey: HDRRMKZWEDGXQP-LTGZKZEYSA-N.
| Molecular formula | C20H18N2O |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 4-[(E)-C-methyl-N-(N-phenylanilino)carbonimidoyl]phenol |
| InChIKey | HDRRMKZWEDGXQP-LTGZKZEYSA-N |
| SMILES | C/C(=N\N(C1=CC=CC=C1)C2=CC=CC=C2)/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)