CAS 1245563-16-9 is the registry number for N-Methyl 4-bromo-2-ethoxybenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
4-bromo-2-ethoxy-N-methylbenzamide (CAS 1245563-16-9) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 4-bromo-2-ethoxy-N-methylbenzamide. InChIKey: BATTWSDSGWAEMC-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 4-bromo-2-ethoxy-N-methylbenzamide |
| InChIKey | BATTWSDSGWAEMC-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)Br)C(=O)NC |
Computed by PubChem (NCBI)