Products 1245609-14-6
CAS 1245609-14-6 is the registry number for 1,1-Dimethylethyl (2R,6S)-2,6-bis(hydroxymethyl)-4-morpholinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (2R,6S)-2,6-bis(hydroxymethyl)morpholine-4-carboxylate (CAS 1245609-14-6) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl (2R,6S)-2,6-bis(hydroxymethyl)morpholine-4-carboxylate. InChIKey: MOHPQLNETOHYNP-DTORHVGOSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl (2R,6S)-2,6-bis(hydroxymethyl)morpholine-4-carboxylate |
| InChIKey | MOHPQLNETOHYNP-DTORHVGOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O[C@@H](C1)CO)CO |
Computed by PubChem (NCBI)