Products 1245772-14-8
CAS 1245772-14-8 is the registry number for 2-(Difluoromethoxy)-4-methyl-1-nitrobenzene. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(difluoromethoxy)-4-methyl-1-nitrobenzene (CAS 1245772-14-8) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2-(difluoromethoxy)-4-methyl-1-nitrobenzene. InChIKey: ZHFMXJOSNWFUND-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2-(difluoromethoxy)-4-methyl-1-nitrobenzene |
| InChIKey | ZHFMXJOSNWFUND-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])OC(F)F |
Computed by PubChem (NCBI)