CAS 1246509-65-8 is the registry number for Methyl (R)-1-amino-2,3-dihydro-1H-indene-4-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl (1R)-1-amino-2,3-dihydro-1H-indene-4-carboxylate;hydrochloride (CAS 1246509-65-8) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl (1R)-1-amino-2,3-dihydro-1H-indene-4-carboxylate;hydrochloride. InChIKey: KQXATEZZJUKUGF-HNCPQSOCSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl (1R)-1-amino-2,3-dihydro-1H-indene-4-carboxylate;hydrochloride |
| InChIKey | KQXATEZZJUKUGF-HNCPQSOCSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1CC[C@H]2N.Cl |
Computed by PubChem (NCBI)