CAS 2102410-29-5 appears in our catalog under these names: Methyl 1-amino-2,3-dihydro-1h-indene-4-carboxylate hydrochloride, 95%, Methyl 1-amino-2,3-dihydro-1H-indene-4-carboxylate hydrochloride, Methyl 1-amino-2,3-dihydro-1H-indene-4-carboxylate hydrochloride, 95+%, 95+%, METHYL 1-AMINO-2,3-DIHYDRO-1H-INDENE-4-CARBOXYLATE HYDROCHLORIDE, 98%, Methyl 1-amino-2,3-dihydro-1H-indene-4-carboxylate hydrochloride, 95+%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 2,5g, 100mg, 5g.
Methyl 1-amino-2,3-dihydro-1H-indene-4-carboxylate;hydrochloride (CAS 2102410-29-5) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 1-amino-2,3-dihydro-1H-indene-4-carboxylate;hydrochloride. InChIKey: KQXATEZZJUKUGF-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 1-amino-2,3-dihydro-1H-indene-4-carboxylate;hydrochloride |
| InChIKey | KQXATEZZJUKUGF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1CCC2N.Cl |
Computed by PubChem (NCBI)