CAS 1246509-67-0 appears in our catalog under these names: (R)-Methyl 3-amino-2,3-dihydro-1h-indene-5-carboxylate hydrochloride, 95%, (R)–Methyl 3–amino–2,3–dihydro–1H–indene–5–carboxylate hydrochloride, (R)-Methyl 3-amino-2,3-dihydro-1H-indene-5-carboxylate hydrochloride ee, (R)-Methyl 3-amino-2,3-dihydro-1H-indene-5-carboxylate hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg, 2.5g.
Methyl (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride (CAS 1246509-67-0) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride. InChIKey: RSENWQHYPMZMBK-HNCPQSOCSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride |
| InChIKey | RSENWQHYPMZMBK-HNCPQSOCSA-N |
| SMILES | COC(=O)C1=CC2=C(CC[C@H]2N)C=C1.Cl |
Computed by PubChem (NCBI)