CAS 903558-73-6 appears in our catalog under these names: Methyl 3-amino-2,3-dihydro-1H-indene-5-carboxylate hydrochloride, 98%, Methyl 3-amino-2,3-dihydro-1H-indene-5-carboxylate hydrochloride, 98%, 98%, METHYL 3-AMINO-2,3-DIHYDRO-1H-INDENE-5-CARBOXYLATE HCL, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 3-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride (CAS 903558-73-6) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 3-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride. InChIKey: RSENWQHYPMZMBK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 3-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride |
| InChIKey | RSENWQHYPMZMBK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCC2N)C=C1.Cl |
Computed by PubChem (NCBI)