CAS 1246509-73-8 appears in our catalog under these names: (S)-Methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride, 95%, (S)–Methyl 8–amino–5,6,7,8–tetrahydronaphthalene–2–carboxylate hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
Methyl (8S)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride (CAS 1246509-73-8) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl (8S)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride. InChIKey: WHSIBJZKBMEFNO-MERQFXBCSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | methyl (8S)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride |
| InChIKey | WHSIBJZKBMEFNO-MERQFXBCSA-N |
| SMILES | COC(=O)C1=CC2=C(CCC[C@@H]2N)C=C1.Cl |
Computed by PubChem (NCBI)