CAS 1956309-44-6 appears in our catalog under these names: Methyl 8–amino–5,6,7,8–tetrahydronaphthalene–2–carboxylate hydrochloride, Methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate HCl, Methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride, 95%, 95%, Methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 0,5g, 50mg, 1g.
Methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride (CAS 1956309-44-6) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride. InChIKey: WHSIBJZKBMEFNO-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | methyl 8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylate;hydrochloride |
| InChIKey | WHSIBJZKBMEFNO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCCC2N)C=C1.Cl |
Computed by PubChem (NCBI)