Products 1246548-14-0
CAS 1246548-14-0 is the registry number for 2-(Difluoromethyl)-1H-1,3-benzodiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(difluoromethyl)-1H-benzimidazole-4-carboxylic acid (CAS 1246548-14-0) is a chemical compound with the molecular formula C9H6F2N2O2 and a molecular weight of 212.15 g/mol. IUPAC name: 2-(difluoromethyl)-1H-benzimidazole-4-carboxylic acid. InChIKey: BXTKIICKSORLEJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O2 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | 2-(difluoromethyl)-1H-benzimidazole-4-carboxylic acid |
| InChIKey | BXTKIICKSORLEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=N2)C(F)F)C(=O)O |
Computed by PubChem (NCBI)