Products 1329166-90-6
CAS 1329166-90-6 appears in our catalog under these names: 4,6-Difluoro-1-methyl-1h-indazole-5-carboxylic acid, 95%, 4，6–Difluoro–1–methyl–1H–indazole–5–carboxylic acid, 4,6-Difluoro-1-methyl-1H-indazole-5-carboxylic acid, 97%, 97%, 4,6-Difluoro-1-methyl-1H-indazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 50mg.
4,6-difluoro-1-methylindazole-5-carboxylic acid (CAS 1329166-90-6) is a chemical compound with the molecular formula C9H6F2N2O2 and a molecular weight of 212.15 g/mol. IUPAC name: 4,6-difluoro-1-methylindazole-5-carboxylic acid. InChIKey: OOMWZBMYRQKNBY-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O2 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | 4,6-difluoro-1-methylindazole-5-carboxylic acid |
| InChIKey | OOMWZBMYRQKNBY-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=C(C(=C2C=N1)F)C(=O)O)F |
Computed by PubChem (NCBI)